C14H13F3N4O5 — CID 54758191
(6S)-2-nitro-6-[2-[[6-(trifluoromethyl)-3-pyridinyl]oxy]ethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 54758191) has the molecular formula C14H13F3N4O5 and a molecular weight of 374.28 g/mol. Its IUPAC name is (6S)-2-nitro-6-[2-[[6-(trifluoromethyl)-3-pyridinyl]oxy]ethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-2-nitro-6-[2-[[6-(trifluoromethyl)-3-pyridinyl]oxy]ethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 54758191 |
| Molecular Formula | C14H13F3N4O5 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (6S)-2-nitro-6-[2-[[6-(trifluoromethyl)-3-pyridinyl]oxy]ethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCCOc1ccc(C(F)(F)F)nc1)C2 |
| InChI | InChI=1S/C14H13F3N4O5/c15-14(16,17)11-2-1-9(5-18-11)24-3-4-25-10-6-20-7-12(21(22)23)19-13(20)26-8-10/h1-2,5,7,10H,3-4,6,8H2/t10-/m0/s1 |
| InChIKey | UMQPCBGONQGZDQ-JTQLQIEISA-N |
| XLogP | 2.06 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|