C22H24Cl3N3O — CID 54758201
5,7-dichloro-3-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one (PubChem CID 54758201) has the molecular formula C22H24Cl3N3O and a molecular weight of 452.81 g/mol. Its IUPAC name is 5,7-dichloro-3-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one.
| Compound Name | 5,7-dichloro-3-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 54758201 |
| Molecular Formula | C22H24Cl3N3O |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 5,7-dichloro-3-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2c(Cl)cc(Cl)cc2C1CCCCN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H24Cl3N3O/c23-15-4-6-17(7-5-15)28-11-9-27(10-12-28)8-2-1-3-18-19-13-16(24)14-20(25)21(19)26-22(18)29/h4-7,13-14,18H,1-3,8-12H2,(H,26,29) |
| InChIKey | BJHZLZCXLMKSGN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|