About 2-fluoro-N'-propylethanimidamide
2-fluoro-N'-propylethanimidamide (PubChem CID 54758326) has the molecular formula C5H11FN2
and a molecular weight of 118.16 g/mol. Its IUPAC name is 2-fluoro-N'-propylethanimidamide.
Molecular Properties
| Compound Name | 2-fluoro-N'-propylethanimidamide |
| PubChem CID | 54758326 |
| Molecular Formula | C5H11FN2 |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | 2-fluoro-N'-propylethanimidamide |
| SMILES | CCC/N=C(/N)CF |
| InChI | InChI=1S/C5H11FN2/c1-2-3-8-5(7)4-6/h2-4H2,1H3,(H2,7,8) |
| InChIKey | SARPVRSDFMPZPF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-propylethanimidamide?
The IUPAC name of 2-fluoro-N'-propylethanimidamide (CID 54758326) is 2-fluoro-N'-propylethanimidamide.
What is the SMILES notation for 2-fluoro-N'-propylethanimidamide?
The canonical SMILES for 2-fluoro-N'-propylethanimidamide is CCC/N=C(/N)CF.
What is the InChIKey of 2-fluoro-N'-propylethanimidamide?
The InChIKey is SARPVRSDFMPZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11FN2/c1-2-3-8-5(7)4-6/h2-4H2,1H3,(H2,7,8).
What are the key properties of 2-fluoro-N'-propylethanimidamide?
2-fluoro-N'-propylethanimidamide has a molecular weight of 118.16 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-propylethanimidamide is sourced from PubChem (CID 54758326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).