About (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine
(1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine (PubChem CID 54758337) has the molecular formula C18H18Cl3N3
and a molecular weight of 382.72 g/mol. Its IUPAC name is (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine |
| PubChem CID | 54758337 |
| Molecular Formula | C18H18Cl3N3 |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine |
| SMILES | CC(C)[C@H](N)c1nc2cc(Cl)c(Cl)cc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18Cl3N3/c1-10(2)17(22)18-23-15-7-13(20)14(21)8-16(15)24(18)9-11-3-5-12(19)6-4-11/h3-8,10,17H,9,22H2,1-2H3/t17-/m0/s1 |
| InChIKey | LZUPETXUTFQSOZ-KRWDZBQOSA-N |
| XLogP | 5.70 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine?
The IUPAC name of (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine (CID 54758337) is (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine.
What is the SMILES notation for (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine?
The canonical SMILES for (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine is CC(C)[C@H](N)c1nc2cc(Cl)c(Cl)cc2n1Cc1ccc(Cl)cc1.
What is the InChIKey of (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine?
The InChIKey is LZUPETXUTFQSOZ-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H18Cl3N3/c1-10(2)17(22)18-23-15-7-13(20)14(21)8-16(15)24(18)9-11-3-5-12(19)6-4-11/h3-8,10,17H,9,22H2,1-2H3/t17-/m0/s1.
What are the key properties of (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine?
(1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine has a molecular weight of 382.72 g/mol, XLogP of 5.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[5,6-dichloro-1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 54758337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).