About CID 5475849
CID 5475849 (PubChem CID 5475849) has the molecular formula C7H10N
and a molecular weight of 108.16 g/mol.
Molecular Properties
| Compound Name | CID 5475849 |
| PubChem CID | 5475849 |
| Molecular Formula | C7H10N |
| Molecular Weight | 108.16 g/mol |
| Exact Mass | 108.08 |
| IUPAC Name | — |
| SMILES | CC1=C[N]CC(C)=C1 |
| InChI | InChI=1S/C7H10N/c1-6-3-7(2)5-8-4-6/h3-4H,5H2,1-2H3 |
| InChIKey | GKMIUSKYBZZGPN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.16 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 5475849 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5475849?
The IUPAC name of CID 5475849 (CID 5475849) is not available.
What is the SMILES notation for CID 5475849?
The canonical SMILES for CID 5475849 is CC1=C[N]CC(C)=C1.
What is the InChIKey of CID 5475849?
The InChIKey is GKMIUSKYBZZGPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N/c1-6-3-7(2)5-8-4-6/h3-4H,5H2,1-2H3.
What are the key properties of CID 5475849?
CID 5475849 has a molecular weight of 108.16 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5475849 is sourced from PubChem (CID 5475849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).