About 1-ethyl-6,7-difluorobenzimidazole
1-ethyl-6,7-difluorobenzimidazole (PubChem CID 54758749) has the molecular formula C9H8F2N2
and a molecular weight of 182.17 g/mol. Its IUPAC name is 1-ethyl-6,7-difluorobenzimidazole.
Molecular Properties
| Compound Name | 1-ethyl-6,7-difluorobenzimidazole |
| PubChem CID | 54758749 |
| Molecular Formula | C9H8F2N2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-ethyl-6,7-difluorobenzimidazole |
| SMILES | CCn1cnc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C9H8F2N2/c1-2-13-5-12-7-4-3-6(10)8(11)9(7)13/h3-5H,2H2,1H3 |
| InChIKey | XAZWKKRGQRHLPL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-6,7-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6,7-difluorobenzimidazole?
The IUPAC name of 1-ethyl-6,7-difluorobenzimidazole (CID 54758749) is 1-ethyl-6,7-difluorobenzimidazole.
What is the SMILES notation for 1-ethyl-6,7-difluorobenzimidazole?
The canonical SMILES for 1-ethyl-6,7-difluorobenzimidazole is CCn1cnc2ccc(F)c(F)c21.
What is the InChIKey of 1-ethyl-6,7-difluorobenzimidazole?
The InChIKey is XAZWKKRGQRHLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N2/c1-2-13-5-12-7-4-3-6(10)8(11)9(7)13/h3-5H,2H2,1H3.
What are the key properties of 1-ethyl-6,7-difluorobenzimidazole?
1-ethyl-6,7-difluorobenzimidazole has a molecular weight of 182.17 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6,7-difluorobenzimidazole is sourced from PubChem (CID 54758749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).