C12H19BF2O3Si — CID 54758868
[4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid (PubChem CID 54758868) has the molecular formula C12H19BF2O3Si and a molecular weight of 288.18 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid |
|---|---|
| PubChem CID | 54758868 |
| Molecular Formula | C12H19BF2O3Si |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(B(O)O)c(F)c1F |
| InChI | InChI=1S/C12H19BF2O3Si/c1-12(2,3)19(4,5)18-9-7-6-8(13(16)17)10(14)11(9)15/h6-7,16-17H,1-5H3 |
| InChIKey | DODXXNHIJRLFAF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|