About CID 5475931
CID 5475931 (PubChem CID 5475931) has the molecular formula C4H9O
and a molecular weight of 73.12 g/mol.
Molecular Properties
| Compound Name | CID 5475931 |
| PubChem CID | 5475931 |
| Molecular Formula | C4H9O |
| Molecular Weight | 73.12 g/mol |
| Exact Mass | 73.07 |
| IUPAC Name | — |
| SMILES | C[CH]C(C)O |
| InChI | InChI=1S/C4H9O/c1-3-4(2)5/h3-5H,1-2H3 |
| InChIKey | XFYDXZKCQFGUQB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.12 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 5475931 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5475931?
The IUPAC name of CID 5475931 (CID 5475931) is not available.
What is the SMILES notation for CID 5475931?
The canonical SMILES for CID 5475931 is C[CH]C(C)O.
What is the InChIKey of CID 5475931?
The InChIKey is XFYDXZKCQFGUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O/c1-3-4(2)5/h3-5H,1-2H3.
What are the key properties of CID 5475931?
CID 5475931 has a molecular weight of 73.12 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5475931 is sourced from PubChem (CID 5475931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).