C16H21ClO — CID 54759355
(4aR,9R,9aR)-6-chloro-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-fluoren-9-ol (PubChem CID 54759355) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is (4aR,9R,9aR)-6-chloro-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-fluoren-9-ol.
| Compound Name | (4aR,9R,9aR)-6-chloro-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-fluoren-9-ol |
|---|---|
| PubChem CID | 54759355 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (4aR,9R,9aR)-6-chloro-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-fluoren-9-ol |
| SMILES | CC1(C)CCC[C@@]2(C)c3cc(Cl)ccc3[C@H](O)[C@H]12 |
| InChI | InChI=1S/C16H21ClO/c1-15(2)7-4-8-16(3)12-9-10(17)5-6-11(12)13(18)14(15)16/h5-6,9,13-14,18H,4,7-8H2,1-3H3/t13-,14+,16-/m0/s1 |
| InChIKey | JZEWVKJAURFSCT-LZWOXQAQSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |