C32H46N6O7S — CID 54759495
N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-2-methylphenyl]-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide;methanesulfonic acid (PubChem CID 54759495) has the molecular formula C32H46N6O7S and a molecular weight of 658.82 g/mol. Its IUPAC name is N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-2-methylphenyl]-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide;methanesulfonic acid.
| Compound Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-2-methylphenyl]-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 54759495 |
| Molecular Formula | C32H46N6O7S |
| Molecular Weight | 658.82 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-2-methylphenyl]-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1cc(NC(=O)Nc2cc(C(C)(C)C)on2)ccc1NC(=O)c1ccc(OC2CC(C)(C)N(C)C(C)(C)C2)cn1 |
| InChI | InChI=1S/C31H42N6O4.CH4O3S/c1-19-14-20(33-28(39)35-26-15-25(41-36-26)29(2,3)4)10-12-23(19)34-27(38)24-13-11-21(18-32-24)40-22-16-30(5,6)37(9)31(7,8)17-22;1-5(2,3)4/h10-15,18,22H,16-17H2,1-9H3,(H,34,38)(H2,33,35,36,39);1H3,(H,2,3,4) |
| InChIKey | DAYRVPKQYOVFRC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.82 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|