C20H21F3N4O — CID 54759670
N-butyl-5-[6-cyclopropyl-4-methyl-8-(trifluoromethyl)quinolin-2-yl]-1,3,4-oxadiazol-2-amine (PubChem CID 54759670) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is N-butyl-5-[6-cyclopropyl-4-methyl-8-(trifluoromethyl)quinolin-2-yl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-butyl-5-[6-cyclopropyl-4-methyl-8-(trifluoromethyl)quinolin-2-yl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 54759670 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-butyl-5-[6-cyclopropyl-4-methyl-8-(trifluoromethyl)quinolin-2-yl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCCCNc1nnc(-c2cc(C)c3cc(C4CC4)cc(C(F)(F)F)c3n2)o1 |
| InChI | InChI=1S/C20H21F3N4O/c1-3-4-7-24-19-27-26-18(28-19)16-8-11(2)14-9-13(12-5-6-12)10-15(17(14)25-16)20(21,22)23/h8-10,12H,3-7H2,1-2H3,(H,24,27) |
| InChIKey | PHHQHXSNJDEZSF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|