C25H30N8 — CID 54759842
2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-9-propan-2-ylpurine-2,8-diamine (PubChem CID 54759842) has the molecular formula C25H30N8 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-9-propan-2-ylpurine-2,8-diamine.
| Compound Name | 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-9-propan-2-ylpurine-2,8-diamine |
|---|---|
| PubChem CID | 54759842 |
| Molecular Formula | C25H30N8 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-9-propan-2-ylpurine-2,8-diamine |
| SMILES | CC(C)n1c(Nc2ccccc2)nc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C25H30N8/c1-18(2)33-23-22(29-25(33)28-19-7-5-4-6-8-19)17-26-24(30-23)27-20-9-11-21(12-10-20)32-15-13-31(3)14-16-32/h4-12,17-18H,13-16H2,1-3H3,(H,28,29)(H,26,27,30) |
| InChIKey | BJQHKZQCLPRNHN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|