C14H20OS — CID 54759912
(4R,4aS,8aR)-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[1,2-b]thiophen-4-ol (PubChem CID 54759912) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is (4R,4aS,8aR)-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[1,2-b]thiophen-4-ol.
| Compound Name | (4R,4aS,8aR)-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[1,2-b]thiophen-4-ol |
|---|---|
| PubChem CID | 54759912 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (4R,4aS,8aR)-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[1,2-b]thiophen-4-ol |
| SMILES | CC1(C)CCC[C@@]2(C)c3sccc3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C14H20OS/c1-13(2)6-4-7-14(3)11(13)10(15)9-5-8-16-12(9)14/h5,8,10-11,15H,4,6-7H2,1-3H3/t10-,11-,14+/m0/s1 |
| InChIKey | FBVJBBUTFGIEEE-COPLHBTASA-N |
| XLogP | 3.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |