C15H22OS — CID 54759913
(4S,4aS,8aR)-4a,5,5,8a-tetramethyl-4,6,7,8-tetrahydroindeno[1,2-b]thiophen-4-ol (PubChem CID 54759913) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is (4S,4aS,8aR)-4a,5,5,8a-tetramethyl-4,6,7,8-tetrahydroindeno[1,2-b]thiophen-4-ol.
| Compound Name | (4S,4aS,8aR)-4a,5,5,8a-tetramethyl-4,6,7,8-tetrahydroindeno[1,2-b]thiophen-4-ol |
|---|---|
| PubChem CID | 54759913 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (4S,4aS,8aR)-4a,5,5,8a-tetramethyl-4,6,7,8-tetrahydroindeno[1,2-b]thiophen-4-ol |
| SMILES | CC1(C)CCC[C@@]2(C)c3sccc3[C@@H](O)[C@@]12C |
| InChI | InChI=1S/C15H22OS/c1-13(2)7-5-8-14(3)12-10(6-9-17-12)11(16)15(13,14)4/h6,9,11,16H,5,7-8H2,1-4H3/t11-,14+,15+/m1/s1 |
| InChIKey | TYLJGVYXQQLCIZ-UGFHNGPFSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |