About methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate
methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 54759925) has the molecular formula C23H26N4O3S
and a molecular weight of 438.55 g/mol. Its IUPAC name is methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate |
| PubChem CID | 54759925 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2cccnc2OC2CC(Nc3nc4ccccc4s3)C2)CC1 |
| InChI | InChI=1S/C23H26N4O3S/c1-29-23(28)27-11-8-15(9-12-27)18-5-4-10-24-21(18)30-17-13-16(14-17)25-22-26-19-6-2-3-7-20(19)31-22/h2-7,10,15-17H,8-9,11-14H2,1H3,(H,25,26) |
| InChIKey | PDQMWNKSPGNNOB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate?
The IUPAC name of methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate (CID 54759925) is methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate.
What is the SMILES notation for methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate?
The canonical SMILES for methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate is COC(=O)N1CCC(c2cccnc2OC2CC(Nc3nc4ccccc4s3)C2)CC1.
What is the InChIKey of methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate?
The InChIKey is PDQMWNKSPGNNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O3S/c1-29-23(28)27-11-8-15(9-12-27)18-5-4-10-24-21(18)30-17-13-16(14-17)25-22-26-19-6-2-3-7-20(19)31-22/h2-7,10,15-17H,8-9,11-14H2,1H3,(H,25,26).
What are the key properties of methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate?
methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate has a molecular weight of 438.55 g/mol, XLogP of 4.66, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[3-(1,3-benzothiazol-2-ylamino)cyclobutyl]oxy-3-pyridinyl]piperidine-1-carboxylate is sourced from PubChem (CID 54759925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).