C32H32N4O4 — CID 54759958
(E)-3-[4-[[(2R)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]propanoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 54759958) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is (E)-3-[4-[[(2R)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]propanoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(2R)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]propanoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54759958 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (E)-3-[4-[[(2R)-2-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]propanoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | C[C@@H](NC(=O)c1ccc2c(C3CCCCC3)n(-c3ccccc3)nc2c1)C(=O)Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C32H32N4O4/c1-21(31(39)34-25-16-12-22(13-17-25)14-19-29(37)38)33-32(40)24-15-18-27-28(20-24)35-36(26-10-6-3-7-11-26)30(27)23-8-4-2-5-9-23/h3,6-7,10-21,23H,2,4-5,8-9H2,1H3,(H,33,40)(H,34,39)(H,37,38)/b19-14+/t21-/m1/s1 |
| InChIKey | RPYYMTJVCKYLRS-CKNGIZQFSA-N |
| XLogP | 5.93 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|