C32H34ClFN8O — CID 54760030
8-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine (PubChem CID 54760030) has the molecular formula C32H34ClFN8O and a molecular weight of 601.13 g/mol. Its IUPAC name is 8-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine.
| Compound Name | 8-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine |
|---|---|
| PubChem CID | 54760030 |
| Molecular Formula | C32H34ClFN8O |
| Molecular Weight | 601.13 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 8-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine |
| SMILES | CC(C)n1c(Nc2ccc(OCc3cccc(F)c3)c(Cl)c2)nc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C32H34ClFN8O/c1-21(2)42-30-28(19-35-31(39-30)36-24-7-10-26(11-8-24)41-15-13-40(3)14-16-41)38-32(42)37-25-9-12-29(27(33)18-25)43-20-22-5-4-6-23(34)17-22/h4-12,17-19,21H,13-16,20H2,1-3H3,(H,37,38)(H,35,36,39) |
| InChIKey | VSRRLIKKZGFAMN-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.13 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|