C34H37N5O5 — CID 54760143
4-[[1-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-(2-hydroxyethylamino)cyclobutanecarbonyl]amino]benzoic acid (PubChem CID 54760143) has the molecular formula C34H37N5O5 and a molecular weight of 595.70 g/mol. Its IUPAC name is 4-[[1-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-(2-hydroxyethylamino)cyclobutanecarbonyl]amino]benzoic acid.
| Compound Name | 4-[[1-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-(2-hydroxyethylamino)cyclobutanecarbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 54760143 |
| Molecular Formula | C34H37N5O5 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | 4-[[1-[(3-cyclohexyl-2-phenylindazole-6-carbonyl)amino]-3-(2-hydroxyethylamino)cyclobutanecarbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCCC5)n(-c5ccccc5)nc4c3)CC(NCCO)C2)cc1 |
| InChI | InChI=1S/C34H37N5O5/c40-18-17-35-26-20-34(21-26,33(44)36-25-14-11-23(12-15-25)32(42)43)37-31(41)24-13-16-28-29(19-24)38-39(27-9-5-2-6-10-27)30(28)22-7-3-1-4-8-22/h2,5-6,9-16,19,22,26,35,40H,1,3-4,7-8,17-18,20-21H2,(H,36,44)(H,37,41)(H,42,43) |
| InChIKey | RZBXGYZMFJJYHE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |