C35H33ClN6O3 — CID 54760360
6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54760360) has the molecular formula C35H33ClN6O3 and a molecular weight of 621.14 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54760360 |
| Molecular Formula | C35H33ClN6O3 |
| Molecular Weight | 621.14 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc(-c5ccccc5Cl)c(=O)n(C5C(=O)c6ccccc6OC5(C)C)c4n3)cc2)CC1 |
| InChI | InChI=1S/C35H33ClN6O3/c1-35(2)31(30(43)26-9-5-7-11-29(26)45-35)42-32-22(20-27(33(42)44)25-8-4-6-10-28(25)36)21-37-34(39-32)38-23-12-14-24(15-13-23)41-18-16-40(3)17-19-41/h4-15,20-21,31H,16-19H2,1-3H3,(H,37,38,39) |
| InChIKey | URZBWKBRNHHTII-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.14 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|