About 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine
2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine (PubChem CID 54760382) has the molecular formula C22H24N8
and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine.
Molecular Properties
| Compound Name | 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine |
| PubChem CID | 54760382 |
| Molecular Formula | C22H24N8 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4[nH]c(Nc5ccccc5)nc4n3)cc2)CC1 |
| InChI | InChI=1S/C22H24N8/c1-29-11-13-30(14-12-29)18-9-7-17(8-10-18)24-21-23-15-19-20(27-21)28-22(26-19)25-16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3,(H3,23,24,25,26,27,28) |
| InChIKey | FKSOXOHTTFKOQL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine?
The IUPAC name of 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine (CID 54760382) is 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine.
What is the SMILES notation for 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine?
The canonical SMILES for 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine is CN1CCN(c2ccc(Nc3ncc4[nH]c(Nc5ccccc5)nc4n3)cc2)CC1.
What is the InChIKey of 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine?
The InChIKey is FKSOXOHTTFKOQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N8/c1-29-11-13-30(14-12-29)18-9-7-17(8-10-18)24-21-23-15-19-20(27-21)28-22(26-19)25-16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3,(H3,23,24,25,26,27,28).
What are the key properties of 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine?
2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine has a molecular weight of 400.49 g/mol, XLogP of 3.59, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenyl-7H-purine-2,8-diamine is sourced from PubChem (CID 54760382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).