C27H31N9O2 — CID 54760955
9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-(3-nitrophenyl)purine-2,8-diamine (PubChem CID 54760955) has the molecular formula C27H31N9O2 and a molecular weight of 513.61 g/mol. Its IUPAC name is 9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-(3-nitrophenyl)purine-2,8-diamine.
| Compound Name | 9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-(3-nitrophenyl)purine-2,8-diamine |
|---|---|
| PubChem CID | 54760955 |
| Molecular Formula | C27H31N9O2 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-(3-nitrophenyl)purine-2,8-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4nc(Nc5cccc([N+](=O)[O-])c5)n(C5CCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C27H31N9O2/c1-33-13-15-34(16-14-33)21-11-9-19(10-12-21)29-26-28-18-24-25(32-26)35(22-6-2-3-7-22)27(31-24)30-20-5-4-8-23(17-20)36(37)38/h4-5,8-12,17-18,22H,2-3,6-7,13-16H2,1H3,(H,30,31)(H,28,29,32) |
| InChIKey | XUVALDKZKUYGFZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|