C32H28ClFN6O2 — CID 54761113
6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54761113) has the molecular formula C32H28ClFN6O2 and a molecular weight of 583.07 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54761113 |
| Molecular Formula | C32H28ClFN6O2 |
| Molecular Weight | 583.07 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 6-(2-chlorophenyl)-8-(3,4-dihydro-2H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1c(-c2ccccc2Cl)cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc2n1C1COc2ccccc2C1 |
| InChI | InChI=1S/C32H28ClFN6O2/c33-26-7-3-2-6-24(26)25-16-21-18-36-32(37-22-9-10-28(27(34)17-22)39-13-11-35-12-14-39)38-30(21)40(31(25)41)23-15-20-5-1-4-8-29(20)42-19-23/h1-10,16-18,23,35H,11-15,19H2,(H,36,37,38) |
| InChIKey | PVOBGGHTGZKLMR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.07 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|