C34H30ClFN6O3 — CID 54761114
6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54761114) has the molecular formula C34H30ClFN6O3 and a molecular weight of 625.10 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54761114 |
| Molecular Formula | C34H30ClFN6O3 |
| Molecular Weight | 625.10 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | 6-(2-chlorophenyl)-8-(2,2-dimethyl-4-oxo-3H-chromen-3-yl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC1(C)Oc2ccccc2C(=O)C1n1c(=O)c(-c2ccccc2Cl)cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc21 |
| InChI | InChI=1S/C34H30ClFN6O3/c1-34(2)30(29(43)23-8-4-6-10-28(23)45-34)42-31-20(17-24(32(42)44)22-7-3-5-9-25(22)35)19-38-33(40-31)39-21-11-12-27(26(36)18-21)41-15-13-37-14-16-41/h3-12,17-19,30,37H,13-16H2,1-2H3,(H,38,39,40) |
| InChIKey | UKDGLTDUQVCGJO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.10 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|