C28H24F4N6O — CID 54761245
2-(3-fluoro-4-piperazin-1-ylanilino)-6-prop-1-ynyl-8-[[2-(trifluoromethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54761245) has the molecular formula C28H24F4N6O and a molecular weight of 536.53 g/mol. Its IUPAC name is 2-(3-fluoro-4-piperazin-1-ylanilino)-6-prop-1-ynyl-8-[[2-(trifluoromethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3-fluoro-4-piperazin-1-ylanilino)-6-prop-1-ynyl-8-[[2-(trifluoromethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54761245 |
| Molecular Formula | C28H24F4N6O |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-(3-fluoro-4-piperazin-1-ylanilino)-6-prop-1-ynyl-8-[[2-(trifluoromethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC#Cc1cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc2n(Cc2ccccc2C(F)(F)F)c1=O |
| InChI | InChI=1S/C28H24F4N6O/c1-2-5-18-14-20-16-34-27(35-21-8-9-24(23(29)15-21)37-12-10-33-11-13-37)36-25(20)38(26(18)39)17-19-6-3-4-7-22(19)28(30,31)32/h3-4,6-9,14-16,33H,10-13,17H2,1H3,(H,34,35,36) |
| InChIKey | MWWFLJKTKSJKSL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|