C28H34N8 — CID 54761310
9-cyclopentyl-8-N-(3-methylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine (PubChem CID 54761310) has the molecular formula C28H34N8 and a molecular weight of 482.64 g/mol. Its IUPAC name is 9-cyclopentyl-8-N-(3-methylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine.
| Compound Name | 9-cyclopentyl-8-N-(3-methylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine |
|---|---|
| PubChem CID | 54761310 |
| Molecular Formula | C28H34N8 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 9-cyclopentyl-8-N-(3-methylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine |
| SMILES | Cc1cccc(Nc2nc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc3n2C2CCCC2)c1 |
| InChI | InChI=1S/C28H34N8/c1-20-6-5-7-22(18-20)31-28-32-25-19-29-27(33-26(25)36(28)24-8-3-4-9-24)30-21-10-12-23(13-11-21)35-16-14-34(2)15-17-35/h5-7,10-13,18-19,24H,3-4,8-9,14-17H2,1-2H3,(H,31,32)(H,29,30,33) |
| InChIKey | NMRCDQABODRVFG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|