C19H19ClF4N4O2 — CID 54761631
6-chloro-7-(3-fluorophenyl)-2-N-(4,4,4-trifluorobutyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide (PubChem CID 54761631) has the molecular formula C19H19ClF4N4O2 and a molecular weight of 446.83 g/mol. Its IUPAC name is 6-chloro-7-(3-fluorophenyl)-2-N-(4,4,4-trifluorobutyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide.
| Compound Name | 6-chloro-7-(3-fluorophenyl)-2-N-(4,4,4-trifluorobutyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
|---|---|
| PubChem CID | 54761631 |
| Molecular Formula | C19H19ClF4N4O2 |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 6-chloro-7-(3-fluorophenyl)-2-N-(4,4,4-trifluorobutyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
| SMILES | NC(=O)c1c(-c2cccc(F)c2)c(Cl)n2c1CN(C(=O)NCCCC(F)(F)F)CC2 |
| InChI | InChI=1S/C19H19ClF4N4O2/c20-16-14(11-3-1-4-12(21)9-11)15(17(25)29)13-10-27(7-8-28(13)16)18(30)26-6-2-5-19(22,23)24/h1,3-4,9H,2,5-8,10H2,(H2,25,29)(H,26,30) |
| InChIKey | IELRGHSGHRWIRX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|