C29H34ClN3O4 — CID 54762457
N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzo[b]quinolizin-5-ium-9-amine chloride (PubChem CID 54762457) has the molecular formula C29H34ClN3O4 and a molecular weight of 524.06 g/mol. Its IUPAC name is N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzo[b]quinolizin-5-ium-9-amine chloride.
| Compound Name | N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzo[b]quinolizin-5-ium-9-amine chloride |
|---|---|
| PubChem CID | 54762457 |
| Molecular Formula | C29H34ClN3O4 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzo[b]quinolizin-5-ium-9-amine chloride |
| SMILES | [Cl-].c1cc[n+]2cc3ccc(Nc4ccc(N5CCOCCOCCOCCOCC5)cc4)cc3cc2c1 |
| InChI | InChI=1S/C29H33N3O4.ClH/c1-2-10-32-23-24-4-5-27(21-25(24)22-29(32)3-1)30-26-6-8-28(9-7-26)31-11-13-33-15-17-35-19-20-36-18-16-34-14-12-31;/h1-10,21-23H,11-20H2;1H |
| InChIKey | NVRHZWZIWBJIDR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|