C31H47NO4 — CID 54762704
(2S,4R,6S,8S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-9-[(4-methoxyphenyl)methoxy]-N,2,4,6,8-pentamethylnonanamide (PubChem CID 54762704) has the molecular formula C31H47NO4 and a molecular weight of 497.72 g/mol. Its IUPAC name is (2S,4R,6S,8S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-9-[(4-methoxyphenyl)methoxy]-N,2,4,6,8-pentamethylnonanamide.
| Compound Name | (2S,4R,6S,8S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-9-[(4-methoxyphenyl)methoxy]-N,2,4,6,8-pentamethylnonanamide |
|---|---|
| PubChem CID | 54762704 |
| Molecular Formula | C31H47NO4 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | (2S,4R,6S,8S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-9-[(4-methoxyphenyl)methoxy]-N,2,4,6,8-pentamethylnonanamide |
| SMILES | COc1ccc(COC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@H](C)C(=O)N(C)[C@H](C)[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H47NO4/c1-22(18-24(3)20-36-21-27-13-15-29(35-7)16-14-27)17-23(2)19-25(4)31(34)32(6)26(5)30(33)28-11-9-8-10-12-28/h8-16,22-26,30,33H,17-21H2,1-7H3/t22-,23+,24-,25-,26+,30-/m0/s1 |
| InChIKey | XPAHJIJZHYZDSW-FXBNSDBLSA-N |
| XLogP | 6.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |