C25H28ClN3O — CID 547631
7-chloro-1-[3-(dimethylamino)propylimino]-3-(4-methylphenyl)-2,3,4,10-tetrahydroacridin-9-one (PubChem CID 547631) has the molecular formula C25H28ClN3O and a molecular weight of 421.97 g/mol. Its IUPAC name is 7-chloro-1-[3-(dimethylamino)propylimino]-3-(4-methylphenyl)-2,3,4,10-tetrahydroacridin-9-one.
| Compound Name | 7-chloro-1-[3-(dimethylamino)propylimino]-3-(4-methylphenyl)-2,3,4,10-tetrahydroacridin-9-one |
|---|---|
| PubChem CID | 547631 |
| Molecular Formula | C25H28ClN3O |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 7-chloro-1-[3-(dimethylamino)propylimino]-3-(4-methylphenyl)-2,3,4,10-tetrahydroacridin-9-one |
| SMILES | Cc1ccc(C2C/C(=N\CCCN(C)C)c3c([nH]c4ccc(Cl)cc4c3=O)C2)cc1 |
| InChI | InChI=1S/C25H28ClN3O/c1-16-5-7-17(8-6-16)18-13-22(27-11-4-12-29(2)3)24-23(14-18)28-21-10-9-19(26)15-20(21)25(24)30/h5-10,15,18H,4,11-14H2,1-3H3,(H,28,30)/b27-22+ |
| InChIKey | VCRZLGHORPPOPE-HPNDGRJYSA-N |
| XLogP | 4.96 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|