C11H9F13N4S2 — CID 54763564
4-amino-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 54763564) has the molecular formula C11H9F13N4S2 and a molecular weight of 508.33 g/mol. Its IUPAC name is 4-amino-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 54763564 |
| Molecular Formula | C11H9F13N4S2 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 4-amino-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n[nH]c1=S |
| InChI | InChI=1S/C11H9F13N4S2/c12-6(13,1-2-30-3-4-26-27-5(29)28(4)25)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h1-3,25H2,(H,27,29) |
| InChIKey | PBJAFZTWWGSCAA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|