About CID 54763716
CID 54763716 (PubChem CID 54763716) has the molecular formula C16H17N2O2
and a molecular weight of 269.32 g/mol.
Molecular Properties
| Compound Name | CID 54763716 |
| PubChem CID | 54763716 |
| Molecular Formula | C16H17N2O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | — |
| SMILES | COC(=O)[C]1[CH][CH][CH][C]1c1ccccc1/N=C/N(C)C |
| InChI | InChI=1S/C16H17N2O2/c1-18(2)11-17-15-10-5-4-7-13(15)12-8-6-9-14(12)16(19)20-3/h4-11H,1-3H3/b17-11+ |
| InChIKey | BAGQPWPATGBOFK-GZTJUZNOSA-N |
| XLogP | 2.20 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 54763716 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54763716?
The IUPAC name of CID 54763716 (CID 54763716) is not available.
What is the SMILES notation for CID 54763716?
The canonical SMILES for CID 54763716 is COC(=O)[C]1[CH][CH][CH][C]1c1ccccc1/N=C/N(C)C.
What is the InChIKey of CID 54763716?
The InChIKey is BAGQPWPATGBOFK-GZTJUZNOSA-N. The full InChI is InChI=1S/C16H17N2O2/c1-18(2)11-17-15-10-5-4-7-13(15)12-8-6-9-14(12)16(19)20-3/h4-11H,1-3H3/b17-11+.
What are the key properties of CID 54763716?
CID 54763716 has a molecular weight of 269.32 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54763716 is sourced from PubChem (CID 54763716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).