C23H29NO7 — CID 54763758
(4S,7E,9R,10S,13E,15R,16S)-5-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,11-dioxa-5-azacyclohexadeca-7,13-diene-2,6,12-trione (PubChem CID 54763758) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is (4S,7E,9R,10S,13E,15R,16S)-5-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,11-dioxa-5-azacyclohexadeca-7,13-diene-2,6,12-trione.
| Compound Name | (4S,7E,9R,10S,13E,15R,16S)-5-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,11-dioxa-5-azacyclohexadeca-7,13-diene-2,6,12-trione |
|---|---|
| PubChem CID | 54763758 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (4S,7E,9R,10S,13E,15R,16S)-5-benzyl-9,15-dihydroxy-4,10,16-trimethyl-1,11-dioxa-5-azacyclohexadeca-7,13-diene-2,6,12-trione |
| SMILES | C[C@@H]1OC(=O)/C=C/[C@@H](O)[C@H](C)OC(=O)C[C@H](C)N(Cc2ccccc2)C(=O)/C=C/[C@H]1O |
| InChI | InChI=1S/C23H29NO7/c1-15-13-23(29)31-17(3)20(26)10-12-22(28)30-16(2)19(25)9-11-21(27)24(15)14-18-7-5-4-6-8-18/h4-12,15-17,19-20,25-26H,13-14H2,1-3H3/b11-9+,12-10+/t15-,16-,17-,19+,20+/m0/s1 |
| InChIKey | MVWUVQNCENHSNJ-HFQKKVNPSA-N |
| XLogP | 1.50 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |