About N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide
N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide (PubChem CID 54763987) has the molecular formula C23H32ClN3O2
and a molecular weight of 417.98 g/mol. Its IUPAC name is N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide.
Molecular Properties
| Compound Name | N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide |
| PubChem CID | 54763987 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(=O)NC1CC2(CCCCC2)NC2(CCCCC2)C1 |
| InChI | InChI=1S/C23H32ClN3O2/c24-17-7-9-18(10-8-17)25-20(28)21(29)26-19-15-22(11-3-1-4-12-22)27-23(16-19)13-5-2-6-14-23/h7-10,19,27H,1-6,11-16H2,(H,25,28)(H,26,29) |
| InChIKey | QMASZQYVQHXVRI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide?
The IUPAC name of N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide (CID 54763987) is N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide.
What is the SMILES notation for N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide?
The canonical SMILES for N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide is O=C(Nc1ccc(Cl)cc1)C(=O)NC1CC2(CCCCC2)NC2(CCCCC2)C1.
What is the InChIKey of N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide?
The InChIKey is QMASZQYVQHXVRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32ClN3O2/c24-17-7-9-18(10-8-17)25-20(28)21(29)26-19-15-22(11-3-1-4-12-22)27-23(16-19)13-5-2-6-14-23/h7-10,19,27H,1-6,11-16H2,(H,25,28)(H,26,29).
What are the key properties of N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide?
N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide has a molecular weight of 417.98 g/mol, XLogP of 4.55, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-azadispiro[5.1.58.36]hexadecan-15-yl)-N'-(4-chlorophenyl)oxamide is sourced from PubChem (CID 54763987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).