C19H29NO3 — CID 54764033
4,4,6,6,7,7,8,11-octadeuterio-3-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]-9-methoxy-10-(trideuteriomethoxy)-1,2,3,11b-tetrahydrobenzo[a]quinolizin-2-ol (PubChem CID 54764033) has the molecular formula C19H29NO3 and a molecular weight of 339.57 g/mol. Its IUPAC name is 4,4,6,6,7,7,8,11-octadeuterio-3-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]-9-methoxy-10-(trideuteriomethoxy)-1,2,3,11b-tetrahydrobenzo[a]quinolizin-2-ol.
| Compound Name | 4,4,6,6,7,7,8,11-octadeuterio-3-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]-9-methoxy-10-(trideuteriomethoxy)-1,2,3,11b-tetrahydrobenzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 54764033 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.34 |
| IUPAC Name | 4,4,6,6,7,7,8,11-octadeuterio-3-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]-9-methoxy-10-(trideuteriomethoxy)-1,2,3,11b-tetrahydrobenzo[a]quinolizin-2-ol |
| SMILES | [2H]c1c(OC([2H])([2H])[2H])c(OC)c([2H])c2c1C1CC(O)C(C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])N1C([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C19H29NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16-17,21H,5-7,10-11H2,1-4H3/i1D3,2D3,4D3,5D2,6D2,7D2,8D,9D,11D2,12D |
| InChIKey | WEQLWGNDNRARGE-BAPFSBHDSA-N |
| XLogP | 3.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |