C20H19FO2S — CID 54764230
1-[2-(4-cyclopropylphenyl)-4-fluorophenyl]sulfanylcyclobutane-1-carboxylic acid (PubChem CID 54764230) has the molecular formula C20H19FO2S and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[2-(4-cyclopropylphenyl)-4-fluorophenyl]sulfanylcyclobutane-1-carboxylic acid.
| Compound Name | 1-[2-(4-cyclopropylphenyl)-4-fluorophenyl]sulfanylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 54764230 |
| Molecular Formula | C20H19FO2S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-[2-(4-cyclopropylphenyl)-4-fluorophenyl]sulfanylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(Sc2ccc(F)cc2-c2ccc(C3CC3)cc2)CCC1 |
| InChI | InChI=1S/C20H19FO2S/c21-16-8-9-18(24-20(19(22)23)10-1-11-20)17(12-16)15-6-4-14(5-7-15)13-2-3-13/h4-9,12-13H,1-3,10-11H2,(H,22,23) |
| InChIKey | COPXXBHRAFTFFO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |