About 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea
1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea (PubChem CID 54764499) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea |
| PubChem CID | 54764499 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea |
| SMILES | COc1cc2c(cc1OC)/C(=N/NC(=S)Nc1ccccc1)CC2 |
| InChI | InChI=1S/C18H19N3O2S/c1-22-16-10-12-8-9-15(14(12)11-17(16)23-2)20-21-18(24)19-13-6-4-3-5-7-13/h3-7,10-11H,8-9H2,1-2H3,(H2,19,21,24)/b20-15+ |
| InChIKey | ZJQRZHVAFSELTH-HMMYKYKNSA-N |
| XLogP | 3.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea?
The IUPAC name of 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea (CID 54764499) is 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea.
What is the SMILES notation for 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea?
The canonical SMILES for 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea is COc1cc2c(cc1OC)/C(=N/NC(=S)Nc1ccccc1)CC2.
What is the InChIKey of 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea?
The InChIKey is ZJQRZHVAFSELTH-HMMYKYKNSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-22-16-10-12-8-9-15(14(12)11-17(16)23-2)20-21-18(24)19-13-6-4-3-5-7-13/h3-7,10-11H,8-9H2,1-2H3,(H2,19,21,24)/b20-15+.
What are the key properties of 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea?
1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea has a molecular weight of 341.44 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]-3-phenylthiourea is sourced from PubChem (CID 54764499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).