C31H32F3N3O6 — CID 54764986
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-methoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate (PubChem CID 54764986) has the molecular formula C31H32F3N3O6 and a molecular weight of 599.61 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-methoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-methoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54764986 |
| Molecular Formula | C31H32F3N3O6 |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-methoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate |
| SMILES | COc1ccc(C(Nc2ccccc2)C(=O)O[C@H]2C[N+]3(CC(=O)c4ccccc4)CCC2CC3)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H32N3O4.C2HF3O2/c1-35-27-13-12-23(18-30-27)28(31-24-10-6-3-7-11-24)29(34)36-26-20-32(16-14-22(26)15-17-32)19-25(33)21-8-4-2-5-9-21;3-2(4,5)1(6)7/h2-13,18,22,26,28,31H,14-17,19-20H2,1H3;(H,6,7)/q+1;/p-1/t22?,26-,28?,32?;/m0./s1 |
| InChIKey | QOLSAKRIVHJUIQ-GXSJKMETSA-M |
| XLogP | 3.58 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|