C27H37N2O6P — CID 54765286
tert-butyl N-[(2S)-1-[[(E)-3-diethoxyphosphoryl-1-phenylprop-2-enyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 54765286) has the molecular formula C27H37N2O6P and a molecular weight of 516.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(E)-3-diethoxyphosphoryl-1-phenylprop-2-enyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(E)-3-diethoxyphosphoryl-1-phenylprop-2-enyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54765286 |
| Molecular Formula | C27H37N2O6P |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(E)-3-diethoxyphosphoryl-1-phenylprop-2-enyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCOP(=O)(/C=C/C(NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)c1ccccc1)OCC |
| InChI | InChI=1S/C27H37N2O6P/c1-6-33-36(32,34-7-2)19-18-23(22-16-12-9-13-17-22)28-25(30)24(20-21-14-10-8-11-15-21)29-26(31)35-27(3,4)5/h8-19,23-24H,6-7,20H2,1-5H3,(H,28,30)(H,29,31)/b19-18+/t23?,24-/m0/s1 |
| InChIKey | LHBPFKIZLZZHCH-MJAIPJCCSA-N |
| XLogP | 5.76 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|