C21H18FN3O — CID 54765365
3-(2-fluoro-4-pyridinyl)-7-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine (PubChem CID 54765365) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is 3-(2-fluoro-4-pyridinyl)-7-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(2-fluoro-4-pyridinyl)-7-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 54765365 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-(2-fluoro-4-pyridinyl)-7-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridine |
| SMILES | CC(C)Oc1ccc(-c2ccn3c(-c4ccnc(F)c4)cnc3c2)cc1 |
| InChI | InChI=1S/C21H18FN3O/c1-14(2)26-18-5-3-15(4-6-18)16-8-10-25-19(13-24-21(25)12-16)17-7-9-23-20(22)11-17/h3-14H,1-2H3 |
| InChIKey | AFVHBNKBQFTZKW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|