C34H34N8O5 — CID 54765404
2-N,6-N-bis[4-(2-aminoethoxy)quinolin-2-yl]-4-[2-(prop-2-ynylamino)ethoxy]pyridine-2,6-dicarboxamide (PubChem CID 54765404) has the molecular formula C34H34N8O5 and a molecular weight of 634.70 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(2-aminoethoxy)quinolin-2-yl]-4-[2-(prop-2-ynylamino)ethoxy]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-(2-aminoethoxy)quinolin-2-yl]-4-[2-(prop-2-ynylamino)ethoxy]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 54765404 |
| Molecular Formula | C34H34N8O5 |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 2-N,6-N-bis[4-(2-aminoethoxy)quinolin-2-yl]-4-[2-(prop-2-ynylamino)ethoxy]pyridine-2,6-dicarboxamide |
| SMILES | C#CCNCCOc1cc(C(=O)Nc2cc(OCCN)c3ccccc3n2)nc(C(=O)Nc2cc(OCCN)c3ccccc3n2)c1 |
| InChI | InChI=1S/C34H34N8O5/c1-2-13-37-14-17-45-22-18-27(33(43)41-31-20-29(46-15-11-35)23-7-3-5-9-25(23)39-31)38-28(19-22)34(44)42-32-21-30(47-16-12-36)24-8-4-6-10-26(24)40-32/h1,3-10,18-21,37H,11-17,35-36H2,(H,39,41,43)(H,40,42,44) |
| InChIKey | OFUNOIAHVLGLNI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 188.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|