C48H52Si4 — CID 54765406
trimethyl-[2-[12,21,27-tris(2-trimethylsilylethynyl)-4-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaenyl]ethynyl]silane (PubChem CID 54765406) has the molecular formula C48H52Si4 and a molecular weight of 741.29 g/mol. Its IUPAC name is trimethyl-[2-[12,21,27-tris(2-trimethylsilylethynyl)-4-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[12,21,27-tris(2-trimethylsilylethynyl)-4-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaenyl]ethynyl]silane |
|---|---|
| PubChem CID | 54765406 |
| Molecular Formula | C48H52Si4 |
| Molecular Weight | 741.29 g/mol |
| Exact Mass | 740.31 |
| IUPAC Name | trimethyl-[2-[12,21,27-tris(2-trimethylsilylethynyl)-4-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaenyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1cccc2c1C1c3c(C#C[Si](C)(C)C)cccc3C2C2c3c(C#C[Si](C)(C)C)cccc3C1c1cccc(C#C[Si](C)(C)C)c12 |
| InChI | InChI=1S/C48H52Si4/c1-49(2,3)29-25-33-17-13-21-37-41(33)47-42-34(26-30-50(4,5)6)18-14-22-38(42)45(37)48-43-35(27-31-51(7,8)9)19-15-23-39(43)46(47)40-24-16-20-36(44(40)48)28-32-52(10,11)12/h13-24,45-48H,1-12H3 |
| InChIKey | KICCJZCACHFYOV-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.29 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|