C18H35N7O4 — CID 54765483
(2S)-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 54765483) has the molecular formula C18H35N7O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 54765483 |
| Molecular Formula | C18H35N7O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamidopentanoyl]amino]-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CCC[C@H](NC(C)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C18H35N7O4/c1-5-7-12(23-11(4)26)16(28)24-13(8-6-9-22-18(20)21)17(29)25-14(10(2)3)15(19)27/h10,12-14H,5-9H2,1-4H3,(H2,19,27)(H,23,26)(H,24,28)(H,25,29)(H4,20,21,22)/t12-,13-,14-/m0/s1 |
| InChIKey | LADORHAXPJCFIZ-IHRRRGAJSA-N |
| XLogP | -1.54 |
| TPSA | 194.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|