About (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine
(E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine (PubChem CID 54765530) has the molecular formula C5H9ClN2
and a molecular weight of 132.59 g/mol. Its IUPAC name is (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine |
| PubChem CID | 54765530 |
| Molecular Formula | C5H9ClN2 |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine |
| SMILES | [H]/N=C/C(Cl)=C\N(C)C |
| InChI | InChI=1S/C5H9ClN2/c1-8(2)4-5(6)3-7/h3-4,7H,1-2H3/b5-4+,7-3+ |
| InChIKey | FPRUDUBCOSRBEK-JLVHPEPXSA-N |
| XLogP | 1.28 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine?
The IUPAC name of (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine (CID 54765530) is (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine.
What is the SMILES notation for (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine?
The canonical SMILES for (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine is [H]/N=C/C(Cl)=C\N(C)C.
What is the InChIKey of (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine?
The InChIKey is FPRUDUBCOSRBEK-JLVHPEPXSA-N. The full InChI is InChI=1S/C5H9ClN2/c1-8(2)4-5(6)3-7/h3-4,7H,1-2H3/b5-4+,7-3+.
What are the key properties of (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine?
(E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine has a molecular weight of 132.59 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-chloro-3-imino-N,N-dimethylprop-1-en-1-amine is sourced from PubChem (CID 54765530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).