C28H35N5O2 — CID 54765592
N-cyclopropyl-4-[6-[(3S)-3-hydroxyoct-1-ynyl]-8-(2-methylpropylamino)imidazo[1,2-a]pyrazin-3-yl]benzamide (PubChem CID 54765592) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-[(3S)-3-hydroxyoct-1-ynyl]-8-(2-methylpropylamino)imidazo[1,2-a]pyrazin-3-yl]benzamide.
| Compound Name | N-cyclopropyl-4-[6-[(3S)-3-hydroxyoct-1-ynyl]-8-(2-methylpropylamino)imidazo[1,2-a]pyrazin-3-yl]benzamide |
|---|---|
| PubChem CID | 54765592 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | N-cyclopropyl-4-[6-[(3S)-3-hydroxyoct-1-ynyl]-8-(2-methylpropylamino)imidazo[1,2-a]pyrazin-3-yl]benzamide |
| SMILES | CCCCC[C@H](O)C#Cc1cn2c(-c3ccc(C(=O)NC4CC4)cc3)cnc2c(NCC(C)C)n1 |
| InChI | InChI=1S/C28H35N5O2/c1-4-5-6-7-24(34)15-14-23-18-33-25(17-30-27(33)26(31-23)29-16-19(2)3)20-8-10-21(11-9-20)28(35)32-22-12-13-22/h8-11,17-19,22,24,34H,4-7,12-13,16H2,1-3H3,(H,29,31)(H,32,35)/t24-/m0/s1 |
| InChIKey | QHVPTEROMDCLGB-DEOSSOPVSA-N |
| XLogP | 4.65 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|