About 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile
5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 54765766) has the molecular formula C24H17F3N2O3
and a molecular weight of 438.41 g/mol. Its IUPAC name is 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile |
| PubChem CID | 54765766 |
| Molecular Formula | C24H17F3N2O3 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(Oc2ccc(-n3cc(C(O)CO)c4ccccc43)cc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C24H17F3N2O3/c25-24(26,27)21-10-9-18(11-15(21)12-28)32-17-7-5-16(6-8-17)29-13-20(23(31)14-30)19-3-1-2-4-22(19)29/h1-11,13,23,30-31H,14H2 |
| InChIKey | MACFDTOBTZJXCF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile?
The IUPAC name of 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile (CID 54765766) is 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile?
The canonical SMILES for 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile is N#Cc1cc(Oc2ccc(-n3cc(C(O)CO)c4ccccc43)cc2)ccc1C(F)(F)F.
What is the InChIKey of 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile?
The InChIKey is MACFDTOBTZJXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F3N2O3/c25-24(26,27)21-10-9-18(11-15(21)12-28)32-17-7-5-16(6-8-17)29-13-20(23(31)14-30)19-3-1-2-4-22(19)29/h1-11,13,23,30-31H,14H2.
What are the key properties of 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile?
5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile has a molecular weight of 438.41 g/mol, XLogP of 5.34, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[3-(1,2-dihydroxyethyl)indol-1-yl]phenoxy]-2-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 54765766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).