C17H33N7O4 — CID 54765828
(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]pentanamide (PubChem CID 54765828) has the molecular formula C17H33N7O4 and a molecular weight of 399.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 54765828 |
| Molecular Formula | C17H33N7O4 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]pentanamide |
| SMILES | CC(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C)C(=O)NC(C)C |
| InChI | InChI=1S/C17H33N7O4/c1-9(2)21-14(26)11(4)23-16(28)13(7-6-8-20-17(18)19)24-15(27)10(3)22-12(5)25/h9-11,13H,6-8H2,1-5H3,(H,21,26)(H,22,25)(H,23,28)(H,24,27)(H4,18,19,20)/t10-,11-,13-/m0/s1 |
| InChIKey | JRNRWBLWDYGDTO-GVXVVHGQSA-N |
| XLogP | -1.92 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|