C19H37N7O4 — CID 54765992
(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(pentan-3-ylamino)propan-2-yl]pentanamide (PubChem CID 54765992) has the molecular formula C19H37N7O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(pentan-3-ylamino)propan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(pentan-3-ylamino)propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 54765992 |
| Molecular Formula | C19H37N7O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-oxo-1-(pentan-3-ylamino)propan-2-yl]pentanamide |
| SMILES | CCC(CC)NC(=O)[C@H](C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C19H37N7O4/c1-6-14(7-2)25-16(28)12(4)24-18(30)15(9-8-10-22-19(20)21)26-17(29)11(3)23-13(5)27/h11-12,14-15H,6-10H2,1-5H3,(H,23,27)(H,24,30)(H,25,28)(H,26,29)(H4,20,21,22)/t11-,12-,15-/m0/s1 |
| InChIKey | RMDBISVNAIDQMJ-HUBLWGQQSA-N |
| XLogP | -1.14 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|