C30H33NO4 — CID 54766022
3-(3-hydroxyphenyl)-4-methyl-2-[4-[(2R)-2-[(3S)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-2H-chromen-6-ol (PubChem CID 54766022) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-4-methyl-2-[4-[(2R)-2-[(3S)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-2H-chromen-6-ol.
| Compound Name | 3-(3-hydroxyphenyl)-4-methyl-2-[4-[(2R)-2-[(3S)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-2H-chromen-6-ol |
|---|---|
| PubChem CID | 54766022 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 3-(3-hydroxyphenyl)-4-methyl-2-[4-[(2R)-2-[(3S)-3-methylpyrrolidin-1-yl]propoxy]phenyl]-2H-chromen-6-ol |
| SMILES | CC1=C(c2cccc(O)c2)C(c2ccc(OC[C@@H](C)N3CC[C@H](C)C3)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C30H33NO4/c1-19-13-14-31(17-19)20(2)18-34-26-10-7-22(8-11-26)30-29(23-5-4-6-24(32)15-23)21(3)27-16-25(33)9-12-28(27)35-30/h4-12,15-16,19-20,30,32-33H,13-14,17-18H2,1-3H3/t19-,20+,30?/m0/s1 |
| InChIKey | JPFFAEPFVTWVBI-TURHTGMXSA-N |
| XLogP | 6.27 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|