C29H31NO4 — CID 54766174
3-(3-hydroxyphenyl)-4-methyl-2-[4-[2-[(3S)-3-methylpyrrolidin-1-yl]ethoxy]phenyl]-2H-chromen-6-ol (PubChem CID 54766174) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-4-methyl-2-[4-[2-[(3S)-3-methylpyrrolidin-1-yl]ethoxy]phenyl]-2H-chromen-6-ol.
| Compound Name | 3-(3-hydroxyphenyl)-4-methyl-2-[4-[2-[(3S)-3-methylpyrrolidin-1-yl]ethoxy]phenyl]-2H-chromen-6-ol |
|---|---|
| PubChem CID | 54766174 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 3-(3-hydroxyphenyl)-4-methyl-2-[4-[2-[(3S)-3-methylpyrrolidin-1-yl]ethoxy]phenyl]-2H-chromen-6-ol |
| SMILES | CC1=C(c2cccc(O)c2)C(c2ccc(OCCN3CC[C@H](C)C3)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C29H31NO4/c1-19-12-13-30(18-19)14-15-33-25-9-6-21(7-10-25)29-28(22-4-3-5-23(31)16-22)20(2)26-17-24(32)8-11-27(26)34-29/h3-11,16-17,19,29,31-32H,12-15,18H2,1-2H3/t19-,29?/m0/s1 |
| InChIKey | GPURPDIEDCPRPM-KCHZNAQISA-N |
| XLogP | 5.88 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|