C27H29F3N6O3S — CID 54766249
N-cyclopropyl-4-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)prop-1-ynyl]-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide (PubChem CID 54766249) has the molecular formula C27H29F3N6O3S and a molecular weight of 574.63 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)prop-1-ynyl]-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide.
| Compound Name | N-cyclopropyl-4-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)prop-1-ynyl]-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 54766249 |
| Molecular Formula | C27H29F3N6O3S |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | N-cyclopropyl-4-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)prop-1-ynyl]-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide |
| SMILES | Cc1cc(-c2cnc3c(NCCC(F)(F)F)nc(C#CCN4CCS(=O)(=O)CC4)cn23)ccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C27H29F3N6O3S/c1-18-15-19(4-7-22(18)26(37)34-20-5-6-20)23-16-32-25-24(31-9-8-27(28,29)30)33-21(17-36(23)25)3-2-10-35-11-13-40(38,39)14-12-35/h4,7,15-17,20H,5-6,8-14H2,1H3,(H,31,33)(H,34,37) |
| InChIKey | RVKRMWPRHIZFKN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|